C15H18O2 — CID 15445735
(Z)-2-cyclohexyl-3-phenylprop-2-enoic acid (PubChem CID 15445735) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (Z)-2-cyclohexyl-3-phenylprop-2-enoic acid.
| Compound Name | (Z)-2-cyclohexyl-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 15445735 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (Z)-2-cyclohexyl-3-phenylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H18O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1,3-4,7-8,11,13H,2,5-6,9-10H2,(H,16,17)/b14-11- |
| InChIKey | UOFPJJFOIKKKRT-KAMYIIQDSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|