C15H21N — CID 134993841
(Z)-1-cyclopentyl-N,N-dimethyl-2-phenylethenamine (PubChem CID 134993841) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (Z)-1-cyclopentyl-N,N-dimethyl-2-phenylethenamine.
| Compound Name | (Z)-1-cyclopentyl-N,N-dimethyl-2-phenylethenamine |
|---|---|
| PubChem CID | 134993841 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (Z)-1-cyclopentyl-N,N-dimethyl-2-phenylethenamine |
| SMILES | CN(C)/C(=C\c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C15H21N/c1-16(2)15(14-10-6-7-11-14)12-13-8-4-3-5-9-13/h3-5,8-9,12,14H,6-7,10-11H2,1-2H3/b15-12- |
| InChIKey | BRGCWUUPMLHGBJ-QINSGFPZSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |