C11H15N — CID 12573346
(E)-N,N-dimethyl-1-phenylprop-1-en-2-amine (PubChem CID 12573346) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (E)-N,N-dimethyl-1-phenylprop-1-en-2-amine.
| Compound Name | (E)-N,N-dimethyl-1-phenylprop-1-en-2-amine |
|---|---|
| PubChem CID | 12573346 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (E)-N,N-dimethyl-1-phenylprop-1-en-2-amine |
| SMILES | C/C(=C\c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H15N/c1-10(12(2)3)9-11-7-5-4-6-8-11/h4-9H,1-3H3/b10-9+ |
| InChIKey | ROJYNUOYBPKEOS-MDZDMXLPSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |