carbon monoxide;iron;2-methylprop-1-enylbenzene

C13H12FeO3 — CID 10945570

IUPACcarbon monoxide;iron;2-methylprop-1-enylbenzene
SMILESCC(C)=Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe]
InChIInChI=1S/C10H12.3CO.Fe/c1-9(2)8-10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3;;;;
InChIKeyVBTCHBCSCLFXGR-UHFFFAOYSA-N
MW272.08 g/mol
LogP2.99
Rot. Bonds1

About carbon monoxide;iron;2-methylprop-1-enylbenzene

carbon monoxide;iron;2-methylprop-1-enylbenzene (PubChem CID 10945570) has the molecular formula C13H12FeO3 and a molecular weight of 272.08 g/mol. Its IUPAC name is carbon monoxide;iron;2-methylprop-1-enylbenzene.

Molecular Properties

Compound Namecarbon monoxide;iron;2-methylprop-1-enylbenzene
PubChem CID10945570
Molecular FormulaC13H12FeO3
Molecular Weight272.08 g/mol
Exact Mass272.01
IUPAC Namecarbon monoxide;iron;2-methylprop-1-enylbenzene
SMILESCC(C)=Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe]
InChIInChI=1S/C10H12.3CO.Fe/c1-9(2)8-10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3;;;;
InChIKeyVBTCHBCSCLFXGR-UHFFFAOYSA-N
XLogP2.99
TPSA59.70 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.08
LogP ≤ 52.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze carbon monoxide;iron;2-methylprop-1-enylbenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;iron;2-methylprop-1-enylbenzene?
The IUPAC name of carbon monoxide;iron;2-methylprop-1-enylbenzene (CID 10945570) is carbon monoxide;iron;2-methylprop-1-enylbenzene.
What is the SMILES notation for carbon monoxide;iron;2-methylprop-1-enylbenzene?
The canonical SMILES for carbon monoxide;iron;2-methylprop-1-enylbenzene is CC(C)=Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].
What is the InChIKey of carbon monoxide;iron;2-methylprop-1-enylbenzene?
The InChIKey is VBTCHBCSCLFXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.3CO.Fe/c1-9(2)8-10-6-4-3-5-7-10;3*1-2;/h3-8H,1-2H3;;;;.
What are the key properties of carbon monoxide;iron;2-methylprop-1-enylbenzene?
carbon monoxide;iron;2-methylprop-1-enylbenzene has a molecular weight of 272.08 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;iron;2-methylprop-1-enylbenzene is sourced from PubChem (CID 10945570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).