About 1H-indene;2-methylprop-1-enylbenzene
1H-indene;2-methylprop-1-enylbenzene (PubChem CID 159355673) has the molecular formula C19H20
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1H-indene;2-methylprop-1-enylbenzene.
Molecular Properties
| Compound Name | 1H-indene;2-methylprop-1-enylbenzene |
| PubChem CID | 159355673 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1H-indene;2-methylprop-1-enylbenzene |
| SMILES | C1=Cc2ccccc2C1.CC(C)=Cc1ccccc1 |
| InChI | InChI=1S/C10H12.C9H8/c1-9(2)8-10-6-4-3-5-7-10;1-2-5-9-7-3-6-8(9)4-1/h3-8H,1-2H3;1-6H,7H2 |
| InChIKey | LHWSQOZOSFVTTQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indene;2-methylprop-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;2-methylprop-1-enylbenzene?
The IUPAC name of 1H-indene;2-methylprop-1-enylbenzene (CID 159355673) is 1H-indene;2-methylprop-1-enylbenzene.
What is the SMILES notation for 1H-indene;2-methylprop-1-enylbenzene?
The canonical SMILES for 1H-indene;2-methylprop-1-enylbenzene is C1=Cc2ccccc2C1.CC(C)=Cc1ccccc1.
What is the InChIKey of 1H-indene;2-methylprop-1-enylbenzene?
The InChIKey is LHWSQOZOSFVTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C9H8/c1-9(2)8-10-6-4-3-5-7-10;1-2-5-9-7-3-6-8(9)4-1/h3-8H,1-2H3;1-6H,7H2.
What are the key properties of 1H-indene;2-methylprop-1-enylbenzene?
1H-indene;2-methylprop-1-enylbenzene has a molecular weight of 248.37 g/mol, XLogP of 5.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;2-methylprop-1-enylbenzene is sourced from PubChem (CID 159355673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).