About 1H-indene;phenol;styrene
1H-indene;phenol;styrene (PubChem CID 68536475) has the molecular formula C23H22O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 1H-indene;phenol;styrene.
Molecular Properties
| Compound Name | 1H-indene;phenol;styrene |
| PubChem CID | 68536475 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1H-indene;phenol;styrene |
| SMILES | C1=Cc2ccccc2C1.C=Cc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C9H8.C8H8.C6H6O/c1-2-5-9-7-3-6-8(9)4-1;1-2-8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h1-6H,7H2;2-7H,1H2;1-5,7H |
| InChIKey | GPCXMLFPENNRSI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indene;phenol;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indene;phenol;styrene?
The IUPAC name of 1H-indene;phenol;styrene (CID 68536475) is 1H-indene;phenol;styrene.
What is the SMILES notation for 1H-indene;phenol;styrene?
The canonical SMILES for 1H-indene;phenol;styrene is C1=Cc2ccccc2C1.C=Cc1ccccc1.Oc1ccccc1.
What is the InChIKey of 1H-indene;phenol;styrene?
The InChIKey is GPCXMLFPENNRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C8H8.C6H6O/c1-2-5-9-7-3-6-8(9)4-1;1-2-8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h1-6H,7H2;2-7H,1H2;1-5,7H.
What are the key properties of 1H-indene;phenol;styrene?
1H-indene;phenol;styrene has a molecular weight of 314.43 g/mol, XLogP of 5.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indene;phenol;styrene is sourced from PubChem (CID 68536475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).