About 1-benzofuran;1H-indene;styrene
1-benzofuran;1H-indene;styrene (PubChem CID 158200445) has the molecular formula C25H22O
and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-benzofuran;1H-indene;styrene.
Molecular Properties
| Compound Name | 1-benzofuran;1H-indene;styrene |
| PubChem CID | 158200445 |
| Molecular Formula | C25H22O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-benzofuran;1H-indene;styrene |
| SMILES | C1=Cc2ccccc2C1.C=Cc1ccccc1.c1ccc2occc2c1 |
| InChI | InChI=1S/C9H8.C8H6O.C8H8/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-8-7(3-1)5-6-9-8;1-2-8-6-4-3-5-7-8/h1-6H,7H2;1-6H;2-7H,1H2 |
| InChIKey | GAWCYQRMNLIVFV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzofuran;1H-indene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;1H-indene;styrene?
The IUPAC name of 1-benzofuran;1H-indene;styrene (CID 158200445) is 1-benzofuran;1H-indene;styrene.
What is the SMILES notation for 1-benzofuran;1H-indene;styrene?
The canonical SMILES for 1-benzofuran;1H-indene;styrene is C1=Cc2ccccc2C1.C=Cc1ccccc1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;1H-indene;styrene?
The InChIKey is GAWCYQRMNLIVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C8H6O.C8H8/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-8-7(3-1)5-6-9-8;1-2-8-6-4-3-5-7-8/h1-6H,7H2;1-6H;2-7H,1H2.
What are the key properties of 1-benzofuran;1H-indene;styrene?
1-benzofuran;1H-indene;styrene has a molecular weight of 338.45 g/mol, XLogP of 7.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;1H-indene;styrene is sourced from PubChem (CID 158200445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).