C15H23NO — CID 142206838
N-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]cyclohexanecarboxamide (PubChem CID 142206838) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 142206838 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]cyclohexanecarboxamide |
| SMILES | C=C(/C=C\C(C)=C/C)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H23NO/c1-4-12(2)10-11-13(3)16-15(17)14-8-6-5-7-9-14/h4,10-11,14H,3,5-9H2,1-2H3,(H,16,17)/b11-10-,12-4- |
| InChIKey | HSRKIARCFBAYMR-VVDMYENYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|