C15H25N — CID 170104744
N-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]cyclohexanamine (PubChem CID 170104744) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]cyclohexanamine.
| Compound Name | N-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]cyclohexanamine |
|---|---|
| PubChem CID | 170104744 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[(3Z,5Z)-5-methyl-2-methylidenehepta-3,5-dienyl]cyclohexanamine |
| SMILES | C=C(/C=C\C(C)=C/C)CNC1CCCCC1 |
| InChI | InChI=1S/C15H25N/c1-4-13(2)10-11-14(3)12-16-15-8-6-5-7-9-15/h4,10-11,15-16H,3,5-9,12H2,1-2H3/b11-10-,13-4- |
| InChIKey | YZSXUXDNBLATJW-CFVGIJSGSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|