About 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine
2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine (PubChem CID 143490405) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine |
| PubChem CID | 143490405 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine |
| SMILES | C=C(C)C.C=C(C)NC1CCCCC1 |
| InChI | InChI=1S/C9H17N.C4H8/c1-8(2)10-9-6-4-3-5-7-9;1-4(2)3/h9-10H,1,3-7H2,2H3;1H2,2-3H3 |
| InChIKey | GTRNYLBNAIMVLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine?
The IUPAC name of 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine (CID 143490405) is 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine.
What is the SMILES notation for 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine?
The canonical SMILES for 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine is C=C(C)C.C=C(C)NC1CCCCC1.
What is the InChIKey of 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine?
The InChIKey is GTRNYLBNAIMVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C4H8/c1-8(2)10-9-6-4-3-5-7-9;1-4(2)3/h9-10H,1,3-7H2,2H3;1H2,2-3H3.
What are the key properties of 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine?
2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine has a molecular weight of 195.35 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;N-prop-1-en-2-ylcyclohexanamine is sourced from PubChem (CID 143490405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).