About 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine
1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine (PubChem CID 89294364) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine.
Analyze 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The IUPAC name of 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine (CID 89294364) is 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine.
What is the SMILES notation for 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The canonical SMILES for 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine is C=C(C)NC1CCC(NC)CC1.
What is the InChIKey of 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
The InChIKey is KZWOPTFTVDEMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-8(2)12-10-6-4-9(11-3)5-7-10/h9-12H,1,4-7H2,2-3H3.
What are the key properties of 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine?
1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine has a molecular weight of 168.28 g/mol, XLogP of 1.64, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-4-N-prop-1-en-2-ylcyclohexane-1,4-diamine is sourced from PubChem (CID 89294364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).