C8H15N3 — CID 115612296
1-cyclopropyl-2-(2-methylprop-2-enyl)guanidine (PubChem CID 115612296) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 115612296 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-cyclopropyl-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NC1CC1 |
| InChI | InChI=1S/C8H15N3/c1-6(2)5-10-8(9)11-7-3-4-7/h7H,1,3-5H2,2H3,(H3,9,10,11) |
| InChIKey | LWWZPTYYJNDRSL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|