C14H27IN4O — CID 111075498
N-cyclohexyl-3-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111075498) has the molecular formula C14H27IN4O and a molecular weight of 394.30 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-cyclohexyl-3-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111075498 |
| Molecular Formula | C14H27IN4O |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-cyclohexyl-3-[[N'-(2-methylprop-2-enyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCC(=O)NC1CCCCC1.I |
| InChI | InChI=1S/C14H26N4O.HI/c1-11(2)10-17-14(15)16-9-8-13(19)18-12-6-4-3-5-7-12;/h12H,1,3-10H2,2H3,(H,18,19)(H3,15,16,17);1H |
| InChIKey | QUULLLDIVOONST-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|