C15H28N4O2 — CID 110917892
N-cyclohexyl-3-[[N'-(oxolan-2-ylmethyl)carbamimidoyl]amino]propanamide (PubChem CID 110917892) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-cyclohexyl-3-[[N'-(oxolan-2-ylmethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[N'-(oxolan-2-ylmethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 110917892 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-cyclohexyl-3-[[N'-(oxolan-2-ylmethyl)carbamimidoyl]amino]propanamide |
| SMILES | N/C(=N\CC1CCCO1)NCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H28N4O2/c16-15(18-11-13-7-4-10-21-13)17-9-8-14(20)19-12-5-2-1-3-6-12/h12-13H,1-11H2,(H,19,20)(H3,16,17,18) |
| InChIKey | CXCDNYJCQDFUTK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|