C11H22N4O — CID 62364297
2-[[amino-(cyclohexylamino)methylidene]amino]-N-ethylacetamide (PubChem CID 62364297) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[[amino-(cyclohexylamino)methylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[amino-(cyclohexylamino)methylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 62364297 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-[[amino-(cyclohexylamino)methylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\N)NC1CCCCC1 |
| InChI | InChI=1S/C11H22N4O/c1-2-13-10(16)8-14-11(12)15-9-6-4-3-5-7-9/h9H,2-8H2,1H3,(H,13,16)(H3,12,14,15) |
| InChIKey | SFWNABIOSRCBBA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|