C10H21N5O — CID 104883990
2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N-ethylacetamide (PubChem CID 104883990) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N-ethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 104883990 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)C/N=C(\NN)NC1CCCC1 |
| InChI | InChI=1S/C10H21N5O/c1-2-12-9(16)7-13-10(15-11)14-8-5-3-4-6-8/h8H,2-7,11H2,1H3,(H,12,16)(H2,13,14,15) |
| InChIKey | OWMNASGGKHADLJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|