C8H17N5O — CID 104882876
2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]acetamide (PubChem CID 104882876) has the molecular formula C8H17N5O and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]acetamide.
| Compound Name | 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]acetamide |
|---|---|
| PubChem CID | 104882876 |
| Molecular Formula | C8H17N5O |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-[[(cyclopentylamino)-hydrazinylmethylidene]amino]acetamide |
| SMILES | NN/C(=N\CC(N)=O)NC1CCCC1 |
| InChI | InChI=1S/C8H17N5O/c9-7(14)5-11-8(13-10)12-6-3-1-2-4-6/h6H,1-5,10H2,(H2,9,14)(H2,11,12,13) |
| InChIKey | FGPNOCGRIFXGGC-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|