C13H27N5O — CID 104888371
3-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N,N-diethylpropanamide (PubChem CID 104888371) has the molecular formula C13H27N5O and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 104888371 |
| Molecular Formula | C13H27N5O |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 3-[[(cyclopentylamino)-hydrazinylmethylidene]amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC/N=C(\NN)NC1CCCC1 |
| InChI | InChI=1S/C13H27N5O/c1-3-18(4-2)12(19)9-10-15-13(17-14)16-11-7-5-6-8-11/h11H,3-10,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | GRAOPGAQDPMQJM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|