C19H38IN5O2 — CID 111942248
3-[[[2-[(2-cyclopentylacetyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111942248) has the molecular formula C19H38IN5O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 3-[[[2-[(2-cyclopentylacetyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[[2-[(2-cyclopentylacetyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111942248 |
| Molecular Formula | C19H38IN5O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 3-[[[2-[(2-cyclopentylacetyl)amino]ethylamino]-(ethylamino)methylidene]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)NCCNC(=O)CC1CCCC1.I |
| InChI | InChI=1S/C19H37N5O2.HI/c1-4-20-19(22-12-11-18(26)24(5-2)6-3)23-14-13-21-17(25)15-16-9-7-8-10-16;/h16H,4-15H2,1-3H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | YIYFBMMKFSAMID-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|