C17H35IN4O — CID 111179117
2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 111179117) has the molecular formula C17H35IN4O and a molecular weight of 438.40 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111179117 |
| Molecular Formula | C17H35IN4O |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)NCCNC(=O)CC1CCCCC1.I |
| InChI | InChI=1S/C17H34N4O.HI/c1-4-18-17(21-13-14(2)3)20-11-10-19-16(22)12-15-8-6-5-7-9-15;/h14-15H,4-13H2,1-3H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | YNNZCRVSYLTZLG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|