C18H36N4OS — CID 111609942
2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]ethyl]acetamide (PubChem CID 111609942) has the molecular formula C18H36N4OS and a molecular weight of 356.58 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111609942 |
| Molecular Formula | C18H36N4OS |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-cyclohexyl-N-[2-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCNC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C18H36N4OS/c1-5-19-17(22-14-18(2,3)24-4)21-12-11-20-16(23)13-15-9-7-6-8-10-15/h15H,5-14H2,1-4H3,(H,20,23)(H2,19,21,22) |
| InChIKey | KHOWKVAJPCZBGT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|