C21H40N4O2 — CID 109476581
2-cyclopentyl-N-[2-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]ethyl]acetamide (PubChem CID 109476581) has the molecular formula C21H40N4O2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 109476581 |
| Molecular Formula | C21H40N4O2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | 2-cyclopentyl-N-[2-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCNC(=O)CC1CCCC1 |
| InChI | InChI=1S/C21H40N4O2/c1-2-22-20(25-17-21(12-15-26)10-6-3-7-11-21)24-14-13-23-19(27)16-18-8-4-5-9-18/h18,26H,2-17H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | VEXMUMMDGIMOIH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|