C21H39N3O3 — CID 109476685
cyclopentyl 4-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]butanoate (PubChem CID 109476685) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is cyclopentyl 4-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]butanoate.
| Compound Name | cyclopentyl 4-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 109476685 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | cyclopentyl 4-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]butanoate |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCCC(=O)OC1CCCC1 |
| InChI | InChI=1S/C21H39N3O3/c1-2-22-20(24-17-21(14-16-25)12-6-3-7-13-21)23-15-8-11-19(26)27-18-9-4-5-10-18/h18,25H,2-17H2,1H3,(H2,22,23,24) |
| InChIKey | GGYKTHFKZYGADQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|