C16H31N3O2 — CID 111828233
cyclopentyl 4-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]butanoate (PubChem CID 111828233) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is cyclopentyl 4-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]butanoate.
| Compound Name | cyclopentyl 4-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111828233 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | cyclopentyl 4-[[N-ethyl-N'-(2-methylpropyl)carbamimidoyl]amino]butanoate |
| SMILES | CCN/C(=N\CC(C)C)NCCCC(=O)OC1CCCC1 |
| InChI | InChI=1S/C16H31N3O2/c1-4-17-16(19-12-13(2)3)18-11-7-10-15(20)21-14-8-5-6-9-14/h13-14H,4-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | APCVESKNQTXIPF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|