C15H31N3O2 — CID 109477564
1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-(2-methoxyethyl)guanidine (PubChem CID 109477564) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 109477564 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-(2-methoxyethyl)guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCOC |
| InChI | InChI=1S/C15H31N3O2/c1-3-16-14(17-10-12-20-2)18-13-15(9-11-19)7-5-4-6-8-15/h19H,3-13H2,1-2H3,(H2,16,17,18) |
| InChIKey | SOZXTJINQGUOHP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|