C17H34IN3O3 — CID 109476604
methyl 3-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 109476604) has the molecular formula C17H34IN3O3 and a molecular weight of 455.38 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 109476604 |
| Molecular Formula | C17H34IN3O3 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-[[1-(2-hydroxyethyl)cyclohexyl]methyl]carbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C17H33N3O3.HI/c1-4-18-16(19-12-14(2)15(22)23-3)20-13-17(10-11-21)8-6-5-7-9-17;/h14,21H,4-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | NQHXCIROSLEIPC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|