C23H39N3O4 — CID 109478085
1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine (PubChem CID 109478085) has the molecular formula C23H39N3O4 and a molecular weight of 421.58 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109478085 |
| Molecular Formula | C23H39N3O4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C23H39N3O4/c1-5-24-22(26-17-23(12-14-27)10-7-6-8-11-23)25-13-9-19-20(29-3)15-18(28-2)16-21(19)30-4/h15-16,27H,5-14,17H2,1-4H3,(H2,24,25,26) |
| InChIKey | UGAIGXNVZQZOIX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|