C17H26F3N3O3 — CID 109474675
1-ethyl-2-(3,3,3-trifluoropropyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine (PubChem CID 109474675) has the molecular formula C17H26F3N3O3 and a molecular weight of 377.41 g/mol. Its IUPAC name is 1-ethyl-2-(3,3,3-trifluoropropyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(3,3,3-trifluoropropyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109474675 |
| Molecular Formula | C17H26F3N3O3 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-ethyl-2-(3,3,3-trifluoropropyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCC(F)(F)F)NCCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C17H26F3N3O3/c1-5-21-16(23-9-7-17(18,19)20)22-8-6-13-14(25-3)10-12(24-2)11-15(13)26-4/h10-11H,5-9H2,1-4H3,(H2,21,22,23) |
| InChIKey | XSKGJVIUODMUCT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|