C21H28N6O3 — CID 111834371
1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine (PubChem CID 111834371) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111834371 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-(2,4,6-trimethoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCCc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C21H28N6O3/c1-5-22-21(24-14-20-26-25-19-8-6-7-11-27(19)20)23-10-9-16-17(29-3)12-15(28-2)13-18(16)30-4/h6-8,11-13H,5,9-10,14H2,1-4H3,(H2,22,23,24) |
| InChIKey | VRBWDAOFEXFQPG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|