C13H27IN4O — CID 110912583
3-[[amino-(cyclohexylamino)methylidene]amino]-N-propylpropanamide;hydroiodide (PubChem CID 110912583) has the molecular formula C13H27IN4O and a molecular weight of 382.29 g/mol. Its IUPAC name is 3-[[amino-(cyclohexylamino)methylidene]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-(cyclohexylamino)methylidene]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110912583 |
| Molecular Formula | C13H27IN4O |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[[amino-(cyclohexylamino)methylidene]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CC/N=C(\N)NC1CCCCC1.I |
| InChI | InChI=1S/C13H26N4O.HI/c1-2-9-15-12(18)8-10-16-13(14)17-11-6-4-3-5-7-11;/h11H,2-10H2,1H3,(H,15,18)(H3,14,16,17);1H |
| InChIKey | NSBMJGHPIPURAI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|