C9H18N4O — CID 79401114
3-[[amino(ethylamino)methylidene]amino]-N-cyclopropylpropanamide (PubChem CID 79401114) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 3-[[amino(ethylamino)methylidene]amino]-N-cyclopropylpropanamide.
| Compound Name | 3-[[amino(ethylamino)methylidene]amino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 79401114 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 3-[[amino(ethylamino)methylidene]amino]-N-cyclopropylpropanamide |
| SMILES | CCN/C(N)=N/CCC(=O)NC1CC1 |
| InChI | InChI=1S/C9H18N4O/c1-2-11-9(10)12-6-5-8(14)13-7-3-4-7/h7H,2-6H2,1H3,(H,13,14)(H3,10,11,12) |
| InChIKey | KVDJQOHKHJUITO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|