About methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine
methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine (PubChem CID 143541445) has the molecular formula C21H41N
and a molecular weight of 307.57 g/mol. Its IUPAC name is methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine.
Molecular Properties
| Compound Name | methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine |
| PubChem CID | 143541445 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine |
| SMILES | C=C(C)C.C=C(C)NC1CCCCCC1.CC1CCCCC1 |
| InChI | InChI=1S/C10H19N.C7H14.C4H8/c1-9(2)11-10-7-5-3-4-6-8-10;1-7-5-3-2-4-6-7;1-4(2)3/h10-11H,1,3-8H2,2H3;7H,2-6H2,1H3;1H2,2-3H3 |
| InChIKey | UGXRBMRSIILORI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine?
The IUPAC name of methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine (CID 143541445) is methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine.
What is the SMILES notation for methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine?
The canonical SMILES for methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine is C=C(C)C.C=C(C)NC1CCCCCC1.CC1CCCCC1.
What is the InChIKey of methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine?
The InChIKey is UGXRBMRSIILORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.C7H14.C4H8/c1-9(2)11-10-7-5-3-4-6-8-10;1-7-5-3-2-4-6-7;1-4(2)3/h10-11H,1,3-8H2,2H3;7H,2-6H2,1H3;1H2,2-3H3.
What are the key properties of methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine?
methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine has a molecular weight of 307.57 g/mol, XLogP of 7.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;2-methylprop-1-ene;N-prop-1-en-2-ylcycloheptanamine is sourced from PubChem (CID 143541445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).