C22H30N2O8 — CID 55355546
bis[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 55355546) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is bis[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | bis[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 55355546 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | bis[2-(cyclohexanecarbonylamino)-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | O=C(COC(=O)/C=C/C(=O)OCC(=O)NC(=O)C1CCCCC1)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O8/c25-17(23-21(29)15-7-3-1-4-8-15)13-31-19(27)11-12-20(28)32-14-18(26)24-22(30)16-9-5-2-6-10-16/h11-12,15-16H,1-10,13-14H2,(H,23,25,29)(H,24,26,30)/b12-11+ |
| InChIKey | RBBQVIRXPKMMHI-VAWYXSNFSA-N |
| XLogP | 1.08 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|