C15H23N3O5 — CID 6232240
ethyl (E)-4-[2-[2-(cyclohexanecarbonylamino)acetyl]hydrazinyl]-4-oxobut-2-enoate (PubChem CID 6232240) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is ethyl (E)-4-[2-[2-(cyclohexanecarbonylamino)acetyl]hydrazinyl]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[2-[2-(cyclohexanecarbonylamino)acetyl]hydrazinyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6232240 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | ethyl (E)-4-[2-[2-(cyclohexanecarbonylamino)acetyl]hydrazinyl]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NNC(=O)CNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H23N3O5/c1-2-23-14(21)9-8-12(19)17-18-13(20)10-16-15(22)11-6-4-3-5-7-11/h8-9,11H,2-7,10H2,1H3,(H,16,22)(H,17,19)(H,18,20)/b9-8+ |
| InChIKey | FFYYXRANORZYBI-CMDGGOBGSA-N |
| XLogP | -0.05 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|