C16H24O6 — CID 174885939
(Z)-4-ethoxy-4-oxobut-2-enoic acid;methyl 2-cyclohexylprop-2-enoate (PubChem CID 174885939) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (Z)-4-ethoxy-4-oxobut-2-enoic acid;methyl 2-cyclohexylprop-2-enoate.
| Compound Name | (Z)-4-ethoxy-4-oxobut-2-enoic acid;methyl 2-cyclohexylprop-2-enoate |
|---|---|
| PubChem CID | 174885939 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (Z)-4-ethoxy-4-oxobut-2-enoic acid;methyl 2-cyclohexylprop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CCCCC1.CCOC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C10H16O2.C6H8O4/c1-8(10(11)12-2)9-6-4-3-5-7-9;1-2-10-6(9)4-3-5(7)8/h9H,1,3-7H2,2H3;3-4H,2H2,1H3,(H,7,8)/b;4-3- |
| InChIKey | XDUVVXNRFHSDBC-QGAMPUOQSA-N |
| XLogP | 2.49 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|