About diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate
diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate (PubChem CID 174899415) has the molecular formula C15H22O7
and a molecular weight of 314.33 g/mol. Its IUPAC name is diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate.
Molecular Properties
| Compound Name | diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate |
| PubChem CID | 174899415 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate |
| SMILES | C=C(CC1CO1)C(=O)OC.CCOC(=O)/C=C\C(=O)OCC |
| InChI | InChI=1S/C8H12O4.C7H10O3/c1-3-11-7(9)5-6-8(10)12-4-2;1-5(7(8)9-2)3-6-4-10-6/h5-6H,3-4H2,1-2H3;6H,1,3-4H2,2H3/b6-5-; |
| InChIKey | IWEBYEHOWPUPDE-YSMBQZINSA-N |
| XLogP | 1.17 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The IUPAC name of diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate (CID 174899415) is diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate.
What is the SMILES notation for diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The canonical SMILES for diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate is C=C(CC1CO1)C(=O)OC.CCOC(=O)/C=C\C(=O)OCC.
What is the InChIKey of diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
The InChIKey is IWEBYEHOWPUPDE-YSMBQZINSA-N. The full InChI is InChI=1S/C8H12O4.C7H10O3/c1-3-11-7(9)5-6-8(10)12-4-2;1-5(7(8)9-2)3-6-4-10-6/h5-6H,3-4H2,1-2H3;6H,1,3-4H2,2H3/b6-5-;.
What are the key properties of diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate?
diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate has a molecular weight of 314.33 g/mol, XLogP of 1.17, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-but-2-enedioate;methyl 2-(oxiran-2-ylmethyl)prop-2-enoate is sourced from PubChem (CID 174899415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).