About methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate
methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate (PubChem CID 174928874) has the molecular formula C32H58O4
and a molecular weight of 506.81 g/mol. Its IUPAC name is methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate.
Molecular Properties
| Compound Name | methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate |
| PubChem CID | 174928874 |
| Molecular Formula | C32H58O4 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.43 |
| IUPAC Name | methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate |
| SMILES | C=C(C(=O)OC)C1CCCCC1.C=C(CCCCCCCCCCCCCCCCCC)C(=O)OC |
| InChI | InChI=1S/C22H42O2.C10H16O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22(23)24-3;1-8(10(11)12-2)9-6-4-3-5-7-9/h2,4-20H2,1,3H3;9H,1,3-7H2,2H3 |
| InChIKey | LLOUZAVYBKQFNC-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate?
The IUPAC name of methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate (CID 174928874) is methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate.
What is the SMILES notation for methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate?
The canonical SMILES for methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate is C=C(C(=O)OC)C1CCCCC1.C=C(CCCCCCCCCCCCCCCCCC)C(=O)OC.
What is the InChIKey of methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate?
The InChIKey is LLOUZAVYBKQFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2.C10H16O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22(23)24-3;1-8(10(11)12-2)9-6-4-3-5-7-9/h2,4-20H2,1,3H3;9H,1,3-7H2,2H3.
What are the key properties of methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate?
methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate has a molecular weight of 506.81 g/mol, XLogP of 9.66, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclohexylprop-2-enoate;methyl 2-methylideneicosanoate is sourced from PubChem (CID 174928874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).