C20H36Br2O2 — CID 129383073
methyl (9R,10S)-9,10-dibromo-2-methylideneoctadecanoate (PubChem CID 129383073) has the molecular formula C20H36Br2O2 and a molecular weight of 468.31 g/mol. Its IUPAC name is methyl (9R,10S)-9,10-dibromo-2-methylideneoctadecanoate.
| Compound Name | methyl (9R,10S)-9,10-dibromo-2-methylideneoctadecanoate |
|---|---|
| PubChem CID | 129383073 |
| Molecular Formula | C20H36Br2O2 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | methyl (9R,10S)-9,10-dibromo-2-methylideneoctadecanoate |
| SMILES | C=C(CCCCCC[C@@H](Br)[C@@H](Br)CCCCCCCC)C(=O)OC |
| InChI | InChI=1S/C20H36Br2O2/c1-4-5-6-7-8-12-15-18(21)19(22)16-13-10-9-11-14-17(2)20(23)24-3/h18-19H,2,4-16H2,1,3H3/t18-,19+/m0/s1 |
| InChIKey | YVYCMTALJLXVMV-RBUKOAKNSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|