C19H34Br2O2 — CID 129383070
(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid (PubChem CID 129383070) has the molecular formula C19H34Br2O2 and a molecular weight of 454.29 g/mol. Its IUPAC name is (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid.
| Compound Name | (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid |
|---|---|
| PubChem CID | 129383070 |
| Molecular Formula | C19H34Br2O2 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid |
| SMILES | C=C(CCCCCC[C@@H](Br)[C@H](Br)CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C19H34Br2O2/c1-3-4-5-6-7-11-14-17(20)18(21)15-12-9-8-10-13-16(2)19(22)23/h17-18H,2-15H2,1H3,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | WPUYGDDMEISOCM-QZTJIDSGSA-N |
| XLogP | 7.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|