(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid

C19H34Br2O2 — CID 129383070

IUPAC(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid
SMILESC=C(CCCCCC[C@@H](Br)[C@H](Br)CCCCCCCC)C(=O)O
InChIInChI=1S/C19H34Br2O2/c1-3-4-5-6-7-11-14-17(20)18(21)15-12-9-8-10-13-16(2)19(22)23/h17-18H,2-15H2,1H3,(H,22,23)/t17-,18-/m1/s1
InChIKeyWPUYGDDMEISOCM-QZTJIDSGSA-N
MW454.29 g/mol
LogP7.25
Rot. Bonds16

About (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid

(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid (PubChem CID 129383070) has the molecular formula C19H34Br2O2 and a molecular weight of 454.29 g/mol. Its IUPAC name is (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid.

Molecular Properties

Compound Name(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid
PubChem CID129383070
Molecular FormulaC19H34Br2O2
Molecular Weight454.29 g/mol
Exact Mass452.09
IUPAC Name(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid
SMILESC=C(CCCCCC[C@@H](Br)[C@H](Br)CCCCCCCC)C(=O)O
InChIInChI=1S/C19H34Br2O2/c1-3-4-5-6-7-11-14-17(20)18(21)15-12-9-8-10-13-16(2)19(22)23/h17-18H,2-15H2,1H3,(H,22,23)/t17-,18-/m1/s1
InChIKeyWPUYGDDMEISOCM-QZTJIDSGSA-N
XLogP7.25
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds16
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500454.29
LogP ≤ 57.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid?
The IUPAC name of (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid (CID 129383070) is (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid.
What is the SMILES notation for (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid?
The canonical SMILES for (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid is C=C(CCCCCC[C@@H](Br)[C@H](Br)CCCCCCCC)C(=O)O.
What is the InChIKey of (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid?
The InChIKey is WPUYGDDMEISOCM-QZTJIDSGSA-N. The full InChI is InChI=1S/C19H34Br2O2/c1-3-4-5-6-7-11-14-17(20)18(21)15-12-9-8-10-13-16(2)19(22)23/h17-18H,2-15H2,1H3,(H,22,23)/t17-,18-/m1/s1.
What are the key properties of (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid?
(9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid has a molecular weight of 454.29 g/mol, XLogP of 7.25, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9R,10R)-9,10-dibromo-2-methylideneoctadecanoic acid is sourced from PubChem (CID 129383070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).