(6S,7R)-6,7-dibromooctadecanoic acid

C18H34Br2O2 — CID 98093279

IUPAC(6S,7R)-6,7-dibromooctadecanoic acid
SMILESCCCCCCCCCCC[C@@H](Br)[C@@H](Br)CCCCC(=O)O
InChIInChI=1S/C18H34Br2O2/c1-2-3-4-5-6-7-8-9-10-13-16(19)17(20)14-11-12-15-18(21)22/h16-17H,2-15H2,1H3,(H,21,22)/t16-,17+/m1/s1
InChIKeySWFMDFRDYDMKQK-SJORKVTESA-N
MW442.28 g/mol
LogP7.08
Rot. Bonds16

About (6S,7R)-6,7-dibromooctadecanoic acid

(6S,7R)-6,7-dibromooctadecanoic acid (PubChem CID 98093279) has the molecular formula C18H34Br2O2 and a molecular weight of 442.28 g/mol. Its IUPAC name is (6S,7R)-6,7-dibromooctadecanoic acid.

Molecular Properties

Compound Name(6S,7R)-6,7-dibromooctadecanoic acid
PubChem CID98093279
Molecular FormulaC18H34Br2O2
Molecular Weight442.28 g/mol
Exact Mass440.09
IUPAC Name(6S,7R)-6,7-dibromooctadecanoic acid
SMILESCCCCCCCCCCC[C@@H](Br)[C@@H](Br)CCCCC(=O)O
InChIInChI=1S/C18H34Br2O2/c1-2-3-4-5-6-7-8-9-10-13-16(19)17(20)14-11-12-15-18(21)22/h16-17H,2-15H2,1H3,(H,21,22)/t16-,17+/m1/s1
InChIKeySWFMDFRDYDMKQK-SJORKVTESA-N
XLogP7.08
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds16
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500442.28
LogP ≤ 57.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze (6S,7R)-6,7-dibromooctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6S,7R)-6,7-dibromooctadecanoic acid?
The IUPAC name of (6S,7R)-6,7-dibromooctadecanoic acid (CID 98093279) is (6S,7R)-6,7-dibromooctadecanoic acid.
What is the SMILES notation for (6S,7R)-6,7-dibromooctadecanoic acid?
The canonical SMILES for (6S,7R)-6,7-dibromooctadecanoic acid is CCCCCCCCCCC[C@@H](Br)[C@@H](Br)CCCCC(=O)O.
What is the InChIKey of (6S,7R)-6,7-dibromooctadecanoic acid?
The InChIKey is SWFMDFRDYDMKQK-SJORKVTESA-N. The full InChI is InChI=1S/C18H34Br2O2/c1-2-3-4-5-6-7-8-9-10-13-16(19)17(20)14-11-12-15-18(21)22/h16-17H,2-15H2,1H3,(H,21,22)/t16-,17+/m1/s1.
What are the key properties of (6S,7R)-6,7-dibromooctadecanoic acid?
(6S,7R)-6,7-dibromooctadecanoic acid has a molecular weight of 442.28 g/mol, XLogP of 7.08, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7R)-6,7-dibromooctadecanoic acid is sourced from PubChem (CID 98093279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).