C15H26 — CID 170590627
[(3E)-nona-1,3-dien-2-yl]cyclohexane (PubChem CID 170590627) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is [(3E)-nona-1,3-dien-2-yl]cyclohexane.
| Compound Name | [(3E)-nona-1,3-dien-2-yl]cyclohexane |
|---|---|
| PubChem CID | 170590627 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | [(3E)-nona-1,3-dien-2-yl]cyclohexane |
| SMILES | C=C(/C=C/CCCCC)C1CCCCC1 |
| InChI | InChI=1S/C15H26/c1-3-4-5-6-8-11-14(2)15-12-9-7-10-13-15/h8,11,15H,2-7,9-10,12-13H2,1H3/b11-8+ |
| InChIKey | NJNDAZGCIZBAJX-DHZHZOJOSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|