C24H40O — CID 89061533
(2E,4E,12Z)-1-cyclohexyloctadeca-2,4,12-trien-1-one (PubChem CID 89061533) has the molecular formula C24H40O and a molecular weight of 344.58 g/mol. Its IUPAC name is (2E,4E,12Z)-1-cyclohexyloctadeca-2,4,12-trien-1-one.
| Compound Name | (2E,4E,12Z)-1-cyclohexyloctadeca-2,4,12-trien-1-one |
|---|---|
| PubChem CID | 89061533 |
| Molecular Formula | C24H40O |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | (2E,4E,12Z)-1-cyclohexyloctadeca-2,4,12-trien-1-one |
| SMILES | CCCCC/C=C\CCCCCC/C=C/C=C/C(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H40O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-24(25)23-20-17-16-18-21-23/h6-7,14-15,19,22-23H,2-5,8-13,16-18,20-21H2,1H3/b7-6-,15-14+,22-19+ |
| InChIKey | KFMLZACWGRJWJO-OYKIVTNKSA-N |
| XLogP | 7.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|