C22H37NO — CID 57338317
(2E,4E,12Z)-1-pyrrolidin-1-yloctadeca-2,4,12-trien-1-one (PubChem CID 57338317) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is (2E,4E,12Z)-1-pyrrolidin-1-yloctadeca-2,4,12-trien-1-one.
| Compound Name | (2E,4E,12Z)-1-pyrrolidin-1-yloctadeca-2,4,12-trien-1-one |
|---|---|
| PubChem CID | 57338317 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | (2E,4E,12Z)-1-pyrrolidin-1-yloctadeca-2,4,12-trien-1-one |
| SMILES | CCCCC/C=C\CCCCCC/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)23-20-17-18-21-23/h6-7,14-16,19H,2-5,8-13,17-18,20-21H2,1H3/b7-6-,15-14+,19-16+ |
| InChIKey | PKPKAHJVCCKKHL-GZHFRCKESA-N |
| XLogP | 6.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|