About S-cyclopentyl dec-2-enethioate
S-cyclopentyl dec-2-enethioate (PubChem CID 76513085) has the molecular formula C15H26OS
and a molecular weight of 254.44 g/mol. Its IUPAC name is S-cyclopentyl dec-2-enethioate.
Molecular Properties
| Compound Name | S-cyclopentyl dec-2-enethioate |
| PubChem CID | 76513085 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | S-cyclopentyl dec-2-enethioate |
| SMILES | CCCCCCCC=CC(=O)SC1CCCC1 |
| InChI | InChI=1S/C15H26OS/c1-2-3-4-5-6-7-8-13-15(16)17-14-11-9-10-12-14/h8,13-14H,2-7,9-12H2,1H3 |
| InChIKey | QYOZKZGRPVAWGU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-cyclopentyl dec-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-cyclopentyl dec-2-enethioate?
The IUPAC name of S-cyclopentyl dec-2-enethioate (CID 76513085) is S-cyclopentyl dec-2-enethioate.
What is the SMILES notation for S-cyclopentyl dec-2-enethioate?
The canonical SMILES for S-cyclopentyl dec-2-enethioate is CCCCCCCC=CC(=O)SC1CCCC1.
What is the InChIKey of S-cyclopentyl dec-2-enethioate?
The InChIKey is QYOZKZGRPVAWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26OS/c1-2-3-4-5-6-7-8-13-15(16)17-14-11-9-10-12-14/h8,13-14H,2-7,9-12H2,1H3.
What are the key properties of S-cyclopentyl dec-2-enethioate?
S-cyclopentyl dec-2-enethioate has a molecular weight of 254.44 g/mol, XLogP of 5.11, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-cyclopentyl dec-2-enethioate is sourced from PubChem (CID 76513085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).