About lithium nonadec-2-enoate
lithium nonadec-2-enoate (PubChem CID 139791513) has the molecular formula C19H35LiO2
and a molecular weight of 302.43 g/mol. Its IUPAC name is lithium nonadec-2-enoate.
Molecular Properties
| Compound Name | lithium nonadec-2-enoate |
| PubChem CID | 139791513 |
| Molecular Formula | C19H35LiO2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | lithium nonadec-2-enoate |
| SMILES | CCCCCCCCCCCCCCCCC=CC(=O)[O-].[Li+] |
| InChI | InChI=1S/C19H36O2.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;/h17-18H,2-16H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | RZXFIGTWZXLEJH-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium nonadec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium nonadec-2-enoate?
The IUPAC name of lithium nonadec-2-enoate (CID 139791513) is lithium nonadec-2-enoate.
What is the SMILES notation for lithium nonadec-2-enoate?
The canonical SMILES for lithium nonadec-2-enoate is CCCCCCCCCCCCCCCCC=CC(=O)[O-].[Li+].
What is the InChIKey of lithium nonadec-2-enoate?
The InChIKey is RZXFIGTWZXLEJH-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H36O2.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;/h17-18H,2-16H2,1H3,(H,20,21);/q;+1/p-1.
What are the key properties of lithium nonadec-2-enoate?
lithium nonadec-2-enoate has a molecular weight of 302.43 g/mol, XLogP of 2.17, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium nonadec-2-enoate is sourced from PubChem (CID 139791513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).