C20H29O2- — CID 21145301
(2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate (PubChem CID 21145301) has the molecular formula C20H29O2- and a molecular weight of 301.45 g/mol. Its IUPAC name is (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate.
| Compound Name | (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 21145301 |
| Molecular Formula | C20H29O2- |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (2E,4Z,6E,8Z,10Z)-icosa-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCC/C=C\C=C/C=C/C=C\C=C\C(=O)[O-] |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h10-19H,2-9H2,1H3,(H,21,22)/p-1/b11-10-,13-12-,15-14+,17-16-,19-18+ |
| InChIKey | SBHCLVQMTBWHCD-XABISJOISA-M |
| XLogP | 4.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|