C22H31KO2 — CID 23712824
potassium (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate (PubChem CID 23712824) has the molecular formula C22H31KO2 and a molecular weight of 366.59 g/mol. Its IUPAC name is potassium (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | potassium (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 23712824 |
| Molecular Formula | C22H31KO2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | potassium (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate |
| SMILES | CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)[O-].[K+] |
| InChI | InChI=1S/C22H32O2.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;/h10-21H,2-9H2,1H3,(H,23,24);/q;+1/p-1/b11-10+,13-12+,15-14+,17-16+,19-18+,21-20+; |
| InChIKey | QIJWSQSBUQCZPL-JXAZXYFGSA-M |
| XLogP | 2.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|