About azanium dec-2-enoate
azanium dec-2-enoate (PubChem CID 162335967) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is azanium dec-2-enoate.
Molecular Properties
| Compound Name | azanium dec-2-enoate |
| PubChem CID | 162335967 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | azanium dec-2-enoate |
| SMILES | CCCCCCCC=CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C10H18O2.H3N/c1-2-3-4-5-6-7-8-9-10(11)12;/h8-9H,2-7H2,1H3,(H,11,12);1H3 |
| InChIKey | PERDSTUUWPTMRS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azanium dec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium dec-2-enoate?
The IUPAC name of azanium dec-2-enoate (CID 162335967) is azanium dec-2-enoate.
What is the SMILES notation for azanium dec-2-enoate?
The canonical SMILES for azanium dec-2-enoate is CCCCCCCC=CC(=O)[O-].[NH4+].
What is the InChIKey of azanium dec-2-enoate?
The InChIKey is PERDSTUUWPTMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.H3N/c1-2-3-4-5-6-7-8-9-10(11)12;/h8-9H,2-7H2,1H3,(H,11,12);1H3.
What are the key properties of azanium dec-2-enoate?
azanium dec-2-enoate has a molecular weight of 187.28 g/mol, XLogP of 2.03, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium dec-2-enoate is sourced from PubChem (CID 162335967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).