C20H32O2 — CID 57259279
7-[(1S,2R)-2-hept-1-enylcyclopentyl]octa-5,7-dienoic acid (PubChem CID 57259279) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 7-[(1S,2R)-2-hept-1-enylcyclopentyl]octa-5,7-dienoic acid.
| Compound Name | 7-[(1S,2R)-2-hept-1-enylcyclopentyl]octa-5,7-dienoic acid |
|---|---|
| PubChem CID | 57259279 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 7-[(1S,2R)-2-hept-1-enylcyclopentyl]octa-5,7-dienoic acid |
| SMILES | C=C(C=CCCCC(=O)O)[C@H]1CCC[C@@H]1C=CCCCCC |
| InChI | InChI=1S/C20H32O2/c1-3-4-5-6-9-13-18-14-11-15-19(18)17(2)12-8-7-10-16-20(21)22/h8-9,12-13,18-19H,2-7,10-11,14-16H2,1H3,(H,21,22)/t18-,19+/m0/s1 |
| InChIKey | IZPJKKBFZAHOBL-RBUKOAKNSA-N |
| XLogP | 5.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|