C11H18O2 — CID 143897565
(1S)-2-[(Z)-hept-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 143897565) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1S)-2-[(Z)-hept-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | (1S)-2-[(Z)-hept-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 143897565 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1S)-2-[(Z)-hept-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCC/C=C\C1C[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-9-8-10(9)11(12)13/h6-7,9-10H,2-5,8H2,1H3,(H,12,13)/b7-6-/t9?,10-/m0/s1 |
| InChIKey | CLAFCBZVDFANRH-JUVJXJPRSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|